C12H23NO5S2 — CID 62084061
N-cyclopentyl-N-(2-hydroxyethyl)-1,1-dioxothiane-4-sulfonamide (PubChem CID 62084061) has the molecular formula C12H23NO5S2 and a molecular weight of 325.45 g/mol. Its IUPAC name is N-cyclopentyl-N-(2-hydroxyethyl)-1,1-dioxothiane-4-sulfonamide.
| Compound Name | N-cyclopentyl-N-(2-hydroxyethyl)-1,1-dioxothiane-4-sulfonamide |
|---|---|
| PubChem CID | 62084061 |
| Molecular Formula | C12H23NO5S2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | N-cyclopentyl-N-(2-hydroxyethyl)-1,1-dioxothiane-4-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)N(CCO)C2CCCC2)CC1 |
| InChI | InChI=1S/C12H23NO5S2/c14-8-7-13(11-3-1-2-4-11)20(17,18)12-5-9-19(15,16)10-6-12/h11-12,14H,1-10H2 |
| InChIKey | PCHOXMLFKVPEEZ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |