C12H24N2O4S2 — CID 60807458
1,1-dioxo-N-piperidin-4-yl-N-propylthiolane-3-sulfonamide (PubChem CID 60807458) has the molecular formula C12H24N2O4S2 and a molecular weight of 324.47 g/mol. Its IUPAC name is 1,1-dioxo-N-piperidin-4-yl-N-propylthiolane-3-sulfonamide.
| Compound Name | 1,1-dioxo-N-piperidin-4-yl-N-propylthiolane-3-sulfonamide |
|---|---|
| PubChem CID | 60807458 |
| Molecular Formula | C12H24N2O4S2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1,1-dioxo-N-piperidin-4-yl-N-propylthiolane-3-sulfonamide |
| SMILES | CCCN(C1CCNCC1)S(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H24N2O4S2/c1-2-8-14(11-3-6-13-7-4-11)20(17,18)12-5-9-19(15,16)10-12/h11-13H,2-10H2,1H3 |
| InChIKey | LKIWRTKSZIGLSN-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |