C15H22Cl2N2O2S — CID 119993752
1-(3,5-dichlorophenyl)-N-piperidin-4-yl-N-propylmethanesulfonamide (PubChem CID 119993752) has the molecular formula C15H22Cl2N2O2S and a molecular weight of 365.33 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-N-piperidin-4-yl-N-propylmethanesulfonamide.
| Compound Name | 1-(3,5-dichlorophenyl)-N-piperidin-4-yl-N-propylmethanesulfonamide |
|---|---|
| PubChem CID | 119993752 |
| Molecular Formula | C15H22Cl2N2O2S |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-N-piperidin-4-yl-N-propylmethanesulfonamide |
| SMILES | CCCN(C1CCNCC1)S(=O)(=O)Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H22Cl2N2O2S/c1-2-7-19(15-3-5-18-6-4-15)22(20,21)11-12-8-13(16)10-14(17)9-12/h8-10,15,18H,2-7,11H2,1H3 |
| InChIKey | PSOLCFJYOPEMJZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |