C17H27ClN2O4S — CID 119994180
methyl 3-[[piperidin-4-yl(propyl)sulfamoyl]methyl]benzoate;hydrochloride (PubChem CID 119994180) has the molecular formula C17H27ClN2O4S and a molecular weight of 390.93 g/mol. Its IUPAC name is methyl 3-[[piperidin-4-yl(propyl)sulfamoyl]methyl]benzoate;hydrochloride.
| Compound Name | methyl 3-[[piperidin-4-yl(propyl)sulfamoyl]methyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 119994180 |
| Molecular Formula | C17H27ClN2O4S |
| Molecular Weight | 390.93 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | methyl 3-[[piperidin-4-yl(propyl)sulfamoyl]methyl]benzoate;hydrochloride |
| SMILES | CCCN(C1CCNCC1)S(=O)(=O)Cc1cccc(C(=O)OC)c1.Cl |
| InChI | InChI=1S/C17H26N2O4S.ClH/c1-3-11-19(16-7-9-18-10-8-16)24(21,22)13-14-5-4-6-15(12-14)17(20)23-2;/h4-6,12,16,18H,3,7-11,13H2,1-2H3;1H |
| InChIKey | WCTMJPPNJYMQCV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.93 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |