C16H24Cl2N2O4S — CID 119993955
methyl 3-chloro-4-[piperidin-4-yl(propyl)sulfamoyl]benzoate;hydrochloride (PubChem CID 119993955) has the molecular formula C16H24Cl2N2O4S and a molecular weight of 411.35 g/mol. Its IUPAC name is methyl 3-chloro-4-[piperidin-4-yl(propyl)sulfamoyl]benzoate;hydrochloride.
| Compound Name | methyl 3-chloro-4-[piperidin-4-yl(propyl)sulfamoyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 119993955 |
| Molecular Formula | C16H24Cl2N2O4S |
| Molecular Weight | 411.35 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | methyl 3-chloro-4-[piperidin-4-yl(propyl)sulfamoyl]benzoate;hydrochloride |
| SMILES | CCCN(C1CCNCC1)S(=O)(=O)c1ccc(C(=O)OC)cc1Cl.Cl |
| InChI | InChI=1S/C16H23ClN2O4S.ClH/c1-3-10-19(13-6-8-18-9-7-13)24(21,22)15-5-4-12(11-14(15)17)16(20)23-2;/h4-5,11,13,18H,3,6-10H2,1-2H3;1H |
| InChIKey | KZPTVUMGROIRAA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |