C15H22Cl2N2O2 — CID 120835241
methyl 4-chloro-3-[[methyl(piperidin-4-yl)amino]methyl]benzoate;hydrochloride (PubChem CID 120835241) has the molecular formula C15H22Cl2N2O2 and a molecular weight of 333.26 g/mol. Its IUPAC name is methyl 4-chloro-3-[[methyl(piperidin-4-yl)amino]methyl]benzoate;hydrochloride.
| Compound Name | methyl 4-chloro-3-[[methyl(piperidin-4-yl)amino]methyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 120835241 |
| Molecular Formula | C15H22Cl2N2O2 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | methyl 4-chloro-3-[[methyl(piperidin-4-yl)amino]methyl]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(Cl)c(CN(C)C2CCNCC2)c1.Cl |
| InChI | InChI=1S/C15H21ClN2O2.ClH/c1-18(13-5-7-17-8-6-13)10-12-9-11(15(19)20-2)3-4-14(12)16;/h3-4,9,13,17H,5-8,10H2,1-2H3;1H |
| InChIKey | OEQBQCOHIWYMRP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |