C13H18Cl2N2O2 — CID 120833596
methyl 4-chloro-3-(piperazin-1-ylmethyl)benzoate;hydrochloride (PubChem CID 120833596) has the molecular formula C13H18Cl2N2O2 and a molecular weight of 305.20 g/mol. Its IUPAC name is methyl 4-chloro-3-(piperazin-1-ylmethyl)benzoate;hydrochloride.
| Compound Name | methyl 4-chloro-3-(piperazin-1-ylmethyl)benzoate;hydrochloride |
|---|---|
| PubChem CID | 120833596 |
| Molecular Formula | C13H18Cl2N2O2 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | methyl 4-chloro-3-(piperazin-1-ylmethyl)benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(Cl)c(CN2CCNCC2)c1.Cl |
| InChI | InChI=1S/C13H17ClN2O2.ClH/c1-18-13(17)10-2-3-12(14)11(8-10)9-16-6-4-15-5-7-16;/h2-3,8,15H,4-7,9H2,1H3;1H |
| InChIKey | FVTVSPRFNZNTEE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |