C15H21ClN2O2 — CID 120836635
methyl 3-[[3-(aminomethyl)piperidin-1-yl]methyl]-4-chlorobenzoate (PubChem CID 120836635) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is methyl 3-[[3-(aminomethyl)piperidin-1-yl]methyl]-4-chlorobenzoate.
| Compound Name | methyl 3-[[3-(aminomethyl)piperidin-1-yl]methyl]-4-chlorobenzoate |
|---|---|
| PubChem CID | 120836635 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | methyl 3-[[3-(aminomethyl)piperidin-1-yl]methyl]-4-chlorobenzoate |
| SMILES | COC(=O)c1ccc(Cl)c(CN2CCCC(CN)C2)c1 |
| InChI | InChI=1S/C15H21ClN2O2/c1-20-15(19)12-4-5-14(16)13(7-12)10-18-6-2-3-11(8-17)9-18/h4-5,7,11H,2-3,6,8-10,17H2,1H3 |
| InChIKey | RNJALHUSCYHBKW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |