C17H23ClN2O2 — CID 120844020
methyl 3-[(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)methyl]-4-chlorobenzoate (PubChem CID 120844020) has the molecular formula C17H23ClN2O2 and a molecular weight of 322.84 g/mol. Its IUPAC name is methyl 3-[(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)methyl]-4-chlorobenzoate.
| Compound Name | methyl 3-[(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)methyl]-4-chlorobenzoate |
|---|---|
| PubChem CID | 120844020 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | methyl 3-[(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)methyl]-4-chlorobenzoate |
| SMILES | COC(=O)c1ccc(Cl)c(CN2CC3CCCC(N)C3C2)c1 |
| InChI | InChI=1S/C17H23ClN2O2/c1-22-17(21)11-5-6-15(18)13(7-11)9-20-8-12-3-2-4-16(19)14(12)10-20/h5-7,12,14,16H,2-4,8-10,19H2,1H3 |
| InChIKey | FKPKZIVMQNHCNX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |