C14H20Cl2N2O2 — CID 120841858
methyl 3-[[2-(aminomethyl)pyrrolidin-1-yl]methyl]-4-chlorobenzoate;hydrochloride (PubChem CID 120841858) has the molecular formula C14H20Cl2N2O2 and a molecular weight of 319.23 g/mol. Its IUPAC name is methyl 3-[[2-(aminomethyl)pyrrolidin-1-yl]methyl]-4-chlorobenzoate;hydrochloride.
| Compound Name | methyl 3-[[2-(aminomethyl)pyrrolidin-1-yl]methyl]-4-chlorobenzoate;hydrochloride |
|---|---|
| PubChem CID | 120841858 |
| Molecular Formula | C14H20Cl2N2O2 |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | methyl 3-[[2-(aminomethyl)pyrrolidin-1-yl]methyl]-4-chlorobenzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(Cl)c(CN2CCCC2CN)c1.Cl |
| InChI | InChI=1S/C14H19ClN2O2.ClH/c1-19-14(18)10-4-5-13(15)11(7-10)9-17-6-2-3-12(17)8-16;/h4-5,7,12H,2-3,6,8-9,16H2,1H3;1H |
| InChIKey | NKTNQJLOYQBFAW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |