C13H18Cl2N2 — CID 86329767
[(2S)-1-[(2,5-dichlorophenyl)methyl]piperidin-2-yl]methanamine (PubChem CID 86329767) has the molecular formula C13H18Cl2N2 and a molecular weight of 273.21 g/mol. Its IUPAC name is [(2S)-1-[(2,5-dichlorophenyl)methyl]piperidin-2-yl]methanamine.
| Compound Name | [(2S)-1-[(2,5-dichlorophenyl)methyl]piperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 86329767 |
| Molecular Formula | C13H18Cl2N2 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | [(2S)-1-[(2,5-dichlorophenyl)methyl]piperidin-2-yl]methanamine |
| SMILES | NC[C@@H]1CCCCN1Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H18Cl2N2/c14-11-4-5-13(15)10(7-11)9-17-6-2-1-3-12(17)8-16/h4-5,7,12H,1-3,6,8-9,16H2/t12-/m0/s1 |
| InChIKey | SWDGRYNBYMKNDM-LBPRGKRZSA-N |
| XLogP | 3.31 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |