C13H17Cl2NO — CID 86329631
[(2R)-1-[(2,5-dichlorophenyl)methyl]piperidin-2-yl]methanol (PubChem CID 86329631) has the molecular formula C13H17Cl2NO and a molecular weight of 274.19 g/mol. Its IUPAC name is [(2R)-1-[(2,5-dichlorophenyl)methyl]piperidin-2-yl]methanol.
| Compound Name | [(2R)-1-[(2,5-dichlorophenyl)methyl]piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 86329631 |
| Molecular Formula | C13H17Cl2NO |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | [(2R)-1-[(2,5-dichlorophenyl)methyl]piperidin-2-yl]methanol |
| SMILES | OC[C@H]1CCCCN1Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H17Cl2NO/c14-11-4-5-13(15)10(7-11)8-16-6-2-1-3-12(16)9-17/h4-5,7,12,17H,1-3,6,8-9H2/t12-/m1/s1 |
| InChIKey | NCPWAVVWGPABNV-GFCCVEGCSA-N |
| XLogP | 3.34 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |