C11H22N2O4S3 — CID 62084057
2-[(1,1-dioxothian-4-yl)sulfonylamino]-2-ethylbutanethioamide (PubChem CID 62084057) has the molecular formula C11H22N2O4S3 and a molecular weight of 342.51 g/mol. Its IUPAC name is 2-[(1,1-dioxothian-4-yl)sulfonylamino]-2-ethylbutanethioamide.
| Compound Name | 2-[(1,1-dioxothian-4-yl)sulfonylamino]-2-ethylbutanethioamide |
|---|---|
| PubChem CID | 62084057 |
| Molecular Formula | C11H22N2O4S3 |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 2-[(1,1-dioxothian-4-yl)sulfonylamino]-2-ethylbutanethioamide |
| SMILES | CCC(CC)(NS(=O)(=O)C1CCS(=O)(=O)CC1)C(N)=S |
| InChI | InChI=1S/C11H22N2O4S3/c1-3-11(4-2,10(12)18)13-20(16,17)9-5-7-19(14,15)8-6-9/h9,13H,3-8H2,1-2H3,(H2,12,18) |
| InChIKey | UEPQALNZNNAQNF-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|