C9H16N2O4S2 — CID 62084942
N-(2-cyanopropan-2-yl)-1,1-dioxothiane-4-sulfonamide (PubChem CID 62084942) has the molecular formula C9H16N2O4S2 and a molecular weight of 280.37 g/mol. Its IUPAC name is N-(2-cyanopropan-2-yl)-1,1-dioxothiane-4-sulfonamide.
| Compound Name | N-(2-cyanopropan-2-yl)-1,1-dioxothiane-4-sulfonamide |
|---|---|
| PubChem CID | 62084942 |
| Molecular Formula | C9H16N2O4S2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | N-(2-cyanopropan-2-yl)-1,1-dioxothiane-4-sulfonamide |
| SMILES | CC(C)(C#N)NS(=O)(=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H16N2O4S2/c1-9(2,7-10)11-17(14,15)8-3-5-16(12,13)6-4-8/h8,11H,3-6H2,1-2H3 |
| InChIKey | ZDZDCHTYXJYNPW-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |