C9H20N4O3S — CID 114813460
3-[cyclopropylsulfamoyl(2-methoxyethyl)amino]propanimidamide (PubChem CID 114813460) has the molecular formula C9H20N4O3S and a molecular weight of 264.35 g/mol. Its IUPAC name is 3-[cyclopropylsulfamoyl(2-methoxyethyl)amino]propanimidamide.
| Compound Name | 3-[cyclopropylsulfamoyl(2-methoxyethyl)amino]propanimidamide |
|---|---|
| PubChem CID | 114813460 |
| Molecular Formula | C9H20N4O3S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 3-[cyclopropylsulfamoyl(2-methoxyethyl)amino]propanimidamide |
| SMILES | [H]/N=C(\N)CCN(CCOC)S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C9H20N4O3S/c1-16-7-6-13(5-4-9(10)11)17(14,15)12-8-2-3-8/h8,12H,2-7H2,1H3,(H3,10,11) |
| InChIKey | UCJAUYMYJIEQQO-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|