C12H23F2N3O — CID 114224130
3-[(3,3-difluorocyclopentyl)methyl-(2-methoxyethyl)amino]propanimidamide (PubChem CID 114224130) has the molecular formula C12H23F2N3O and a molecular weight of 263.33 g/mol. Its IUPAC name is 3-[(3,3-difluorocyclopentyl)methyl-(2-methoxyethyl)amino]propanimidamide.
| Compound Name | 3-[(3,3-difluorocyclopentyl)methyl-(2-methoxyethyl)amino]propanimidamide |
|---|---|
| PubChem CID | 114224130 |
| Molecular Formula | C12H23F2N3O |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.18 |
| IUPAC Name | 3-[(3,3-difluorocyclopentyl)methyl-(2-methoxyethyl)amino]propanimidamide |
| SMILES | [H]/N=C(\N)CCN(CCOC)CC1CCC(F)(F)C1 |
| InChI | InChI=1S/C12H23F2N3O/c1-18-7-6-17(5-3-11(15)16)9-10-2-4-12(13,14)8-10/h10H,2-9H2,1H3,(H3,15,16) |
| InChIKey | VAHJGYMPRAKXEQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|