C9H18N4O3S — CID 114243749
N-[2-(2-aminoethoxy)ethyl]-N,2-dimethylpyrazole-3-sulfonamide (PubChem CID 114243749) has the molecular formula C9H18N4O3S and a molecular weight of 262.33 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)ethyl]-N,2-dimethylpyrazole-3-sulfonamide.
| Compound Name | N-[2-(2-aminoethoxy)ethyl]-N,2-dimethylpyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 114243749 |
| Molecular Formula | C9H18N4O3S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | N-[2-(2-aminoethoxy)ethyl]-N,2-dimethylpyrazole-3-sulfonamide |
| SMILES | CN(CCOCCN)S(=O)(=O)c1ccnn1C |
| InChI | InChI=1S/C9H18N4O3S/c1-12(6-8-16-7-4-10)17(14,15)9-3-5-11-13(9)2/h3,5H,4,6-8,10H2,1-2H3 |
| InChIKey | ZUUNNNCKBXPSCY-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|