About N-(1-aminopropan-2-yl)-N,2-dimethylpyrazole-3-sulfonamide;hydrochloride
N-(1-aminopropan-2-yl)-N,2-dimethylpyrazole-3-sulfonamide;hydrochloride (PubChem CID 120710548) has the molecular formula C8H17ClN4O2S
and a molecular weight of 268.77 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-N,2-dimethylpyrazole-3-sulfonamide;hydrochloride.
Molecular Properties
| Compound Name | N-(1-aminopropan-2-yl)-N,2-dimethylpyrazole-3-sulfonamide;hydrochloride |
| PubChem CID | 120710548 |
| Molecular Formula | C8H17ClN4O2S |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | N-(1-aminopropan-2-yl)-N,2-dimethylpyrazole-3-sulfonamide;hydrochloride |
| SMILES | CC(CN)N(C)S(=O)(=O)c1ccnn1C.Cl |
| InChI | InChI=1S/C8H16N4O2S.ClH/c1-7(6-9)12(3)15(13,14)8-4-5-10-11(8)2;/h4-5,7H,6,9H2,1-3H3;1H |
| InChIKey | CWDABQGDOLDLPJ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1-aminopropan-2-yl)-N,2-dimethylpyrazole-3-sulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-aminopropan-2-yl)-N,2-dimethylpyrazole-3-sulfonamide;hydrochloride?
The IUPAC name of N-(1-aminopropan-2-yl)-N,2-dimethylpyrazole-3-sulfonamide;hydrochloride (CID 120710548) is N-(1-aminopropan-2-yl)-N,2-dimethylpyrazole-3-sulfonamide;hydrochloride.
What is the SMILES notation for N-(1-aminopropan-2-yl)-N,2-dimethylpyrazole-3-sulfonamide;hydrochloride?
The canonical SMILES for N-(1-aminopropan-2-yl)-N,2-dimethylpyrazole-3-sulfonamide;hydrochloride is CC(CN)N(C)S(=O)(=O)c1ccnn1C.Cl.
What is the InChIKey of N-(1-aminopropan-2-yl)-N,2-dimethylpyrazole-3-sulfonamide;hydrochloride?
The InChIKey is CWDABQGDOLDLPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4O2S.ClH/c1-7(6-9)12(3)15(13,14)8-4-5-10-11(8)2;/h4-5,7H,6,9H2,1-3H3;1H.
What are the key properties of N-(1-aminopropan-2-yl)-N,2-dimethylpyrazole-3-sulfonamide;hydrochloride?
N-(1-aminopropan-2-yl)-N,2-dimethylpyrazole-3-sulfonamide;hydrochloride has a molecular weight of 268.77 g/mol, XLogP of -0.19, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-aminopropan-2-yl)-N,2-dimethylpyrazole-3-sulfonamide;hydrochloride is sourced from PubChem (CID 120710548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).