C16H28ClN3O2S — CID 119961266
N-benzyl-N-ethyl-3-(methylaminomethyl)piperidine-1-sulfonamide;hydrochloride (PubChem CID 119961266) has the molecular formula C16H28ClN3O2S and a molecular weight of 361.94 g/mol. Its IUPAC name is N-benzyl-N-ethyl-3-(methylaminomethyl)piperidine-1-sulfonamide;hydrochloride.
| Compound Name | N-benzyl-N-ethyl-3-(methylaminomethyl)piperidine-1-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119961266 |
| Molecular Formula | C16H28ClN3O2S |
| Molecular Weight | 361.94 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N-benzyl-N-ethyl-3-(methylaminomethyl)piperidine-1-sulfonamide;hydrochloride |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)N1CCCC(CNC)C1.Cl |
| InChI | InChI=1S/C16H27N3O2S.ClH/c1-3-18(13-15-8-5-4-6-9-15)22(20,21)19-11-7-10-16(14-19)12-17-2;/h4-6,8-9,16-17H,3,7,10-14H2,1-2H3;1H |
| InChIKey | YYBBUSRRHLOTMY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.94 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |