C11H15NO4S2 — CID 16957631
N-methyl-1,1-dioxo-N-phenylthiolane-3-sulfonamide (PubChem CID 16957631) has the molecular formula C11H15NO4S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-methyl-1,1-dioxo-N-phenylthiolane-3-sulfonamide.
| Compound Name | N-methyl-1,1-dioxo-N-phenylthiolane-3-sulfonamide |
|---|---|
| PubChem CID | 16957631 |
| Molecular Formula | C11H15NO4S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | N-methyl-1,1-dioxo-N-phenylthiolane-3-sulfonamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H15NO4S2/c1-12(10-5-3-2-4-6-10)18(15,16)11-7-8-17(13,14)9-11/h2-6,11H,7-9H2,1H3 |
| InChIKey | CFHAANASKSGORK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |