C15H22N2O4S2 — CID 20995140
3-(4-benzylpiperazin-1-yl)sulfonylthiolane 1,1-dioxide (PubChem CID 20995140) has the molecular formula C15H22N2O4S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 3-(4-benzylpiperazin-1-yl)sulfonylthiolane 1,1-dioxide.
| Compound Name | 3-(4-benzylpiperazin-1-yl)sulfonylthiolane 1,1-dioxide |
|---|---|
| PubChem CID | 20995140 |
| Molecular Formula | C15H22N2O4S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 3-(4-benzylpiperazin-1-yl)sulfonylthiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)N2CCN(Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C15H22N2O4S2/c18-22(19)11-6-15(13-22)23(20,21)17-9-7-16(8-10-17)12-14-4-2-1-3-5-14/h1-5,15H,6-13H2 |
| InChIKey | BQJYCEVHSKDPOY-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |