C18H26N6O4S3 — CID 56522379
2-[[4-(1,1-dioxothiolan-3-yl)sulfonylpiperazin-1-yl]methyl]-4-(2-pyridin-2-ylethyl)-1,2,4-triazole-3-thione (PubChem CID 56522379) has the molecular formula C18H26N6O4S3 and a molecular weight of 486.65 g/mol. Its IUPAC name is 2-[[4-(1,1-dioxothiolan-3-yl)sulfonylpiperazin-1-yl]methyl]-4-(2-pyridin-2-ylethyl)-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-(1,1-dioxothiolan-3-yl)sulfonylpiperazin-1-yl]methyl]-4-(2-pyridin-2-ylethyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 56522379 |
| Molecular Formula | C18H26N6O4S3 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 2-[[4-(1,1-dioxothiolan-3-yl)sulfonylpiperazin-1-yl]methyl]-4-(2-pyridin-2-ylethyl)-1,2,4-triazole-3-thione |
| SMILES | O=S1(=O)CCC(S(=O)(=O)N2CCN(Cn3ncn(CCc4ccccn4)c3=S)CC2)C1 |
| InChI | InChI=1S/C18H26N6O4S3/c25-30(26)12-5-17(13-30)31(27,28)23-10-8-21(9-11-23)15-24-18(29)22(14-20-24)7-4-16-3-1-2-6-19-16/h1-3,6,14,17H,4-5,7-13,15H2 |
| InChIKey | VGCIEBZJHUETCX-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 110.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|