C23H29N5OS — CID 56522510
2-[[4-(2,5-dimethylphenoxy)piperidin-1-yl]methyl]-4-(2-pyridin-2-ylethyl)-1,2,4-triazole-3-thione (PubChem CID 56522510) has the molecular formula C23H29N5OS and a molecular weight of 423.59 g/mol. Its IUPAC name is 2-[[4-(2,5-dimethylphenoxy)piperidin-1-yl]methyl]-4-(2-pyridin-2-ylethyl)-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-(2,5-dimethylphenoxy)piperidin-1-yl]methyl]-4-(2-pyridin-2-ylethyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 56522510 |
| Molecular Formula | C23H29N5OS |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 2-[[4-(2,5-dimethylphenoxy)piperidin-1-yl]methyl]-4-(2-pyridin-2-ylethyl)-1,2,4-triazole-3-thione |
| SMILES | Cc1ccc(C)c(OC2CCN(Cn3ncn(CCc4ccccn4)c3=S)CC2)c1 |
| InChI | InChI=1S/C23H29N5OS/c1-18-6-7-19(2)22(15-18)29-21-9-12-26(13-10-21)17-28-23(30)27(16-25-28)14-8-20-5-3-4-11-24-20/h3-7,11,15-16,21H,8-10,12-14,17H2,1-2H3 |
| InChIKey | RBYWKULCYVRQRP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|