C21H26N2O6S3 — CID 38996665
(3R)-3-[3-(4-benzylpiperazin-1-yl)sulfonylphenyl]sulfonylthiolane 1,1-dioxide (PubChem CID 38996665) has the molecular formula C21H26N2O6S3 and a molecular weight of 498.65 g/mol. Its IUPAC name is (3R)-3-[3-(4-benzylpiperazin-1-yl)sulfonylphenyl]sulfonylthiolane 1,1-dioxide.
| Compound Name | (3R)-3-[3-(4-benzylpiperazin-1-yl)sulfonylphenyl]sulfonylthiolane 1,1-dioxide |
|---|---|
| PubChem CID | 38996665 |
| Molecular Formula | C21H26N2O6S3 |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | (3R)-3-[3-(4-benzylpiperazin-1-yl)sulfonylphenyl]sulfonylthiolane 1,1-dioxide |
| SMILES | O=S1(=O)CC[C@@H](S(=O)(=O)c2cccc(S(=O)(=O)N3CCN(Cc4ccccc4)CC3)c2)C1 |
| InChI | InChI=1S/C21H26N2O6S3/c24-30(25)14-9-21(17-30)31(26,27)19-7-4-8-20(15-19)32(28,29)23-12-10-22(11-13-23)16-18-5-2-1-3-6-18/h1-8,15,21H,9-14,16-17H2/t21-/m1/s1 |
| InChIKey | BPZIKZPPAOWLPS-OAQYLSRUSA-N |
| XLogP | 1.15 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |