C14H19NO5S — CID 20993517
2-[2-[(1,1-dioxothiolan-3-yl)-methylamino]ethoxy]benzoic acid (PubChem CID 20993517) has the molecular formula C14H19NO5S and a molecular weight of 313.37 g/mol. Its IUPAC name is 2-[2-[(1,1-dioxothiolan-3-yl)-methylamino]ethoxy]benzoic acid.
| Compound Name | 2-[2-[(1,1-dioxothiolan-3-yl)-methylamino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 20993517 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-[2-[(1,1-dioxothiolan-3-yl)-methylamino]ethoxy]benzoic acid |
| SMILES | CN(CCOc1ccccc1C(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H19NO5S/c1-15(11-6-9-21(18,19)10-11)7-8-20-13-5-3-2-4-12(13)14(16)17/h2-5,11H,6-10H2,1H3,(H,16,17) |
| InChIKey | UVDZPSLRSWUPKB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |