About [4-fluoro-3-(trifluoromethyl)phenyl] prop-1-ene-2-sulfonate
[4-fluoro-3-(trifluoromethyl)phenyl] prop-1-ene-2-sulfonate (PubChem CID 118593226) has the molecular formula C10H8F4O3S
and a molecular weight of 284.23 g/mol. Its IUPAC name is [4-fluoro-3-(trifluoromethyl)phenyl] prop-1-ene-2-sulfonate.
Molecular Properties
| Compound Name | [4-fluoro-3-(trifluoromethyl)phenyl] prop-1-ene-2-sulfonate |
| PubChem CID | 118593226 |
| Molecular Formula | C10H8F4O3S |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | [4-fluoro-3-(trifluoromethyl)phenyl] prop-1-ene-2-sulfonate |
| SMILES | C=C(C)S(=O)(=O)Oc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8F4O3S/c1-6(2)18(15,16)17-7-3-4-9(11)8(5-7)10(12,13)14/h3-5H,1H2,2H3 |
| InChIKey | LEZYPTMIILFQDP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-fluoro-3-(trifluoromethyl)phenyl] prop-1-ene-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-fluoro-3-(trifluoromethyl)phenyl] prop-1-ene-2-sulfonate?
The IUPAC name of [4-fluoro-3-(trifluoromethyl)phenyl] prop-1-ene-2-sulfonate (CID 118593226) is [4-fluoro-3-(trifluoromethyl)phenyl] prop-1-ene-2-sulfonate.
What is the SMILES notation for [4-fluoro-3-(trifluoromethyl)phenyl] prop-1-ene-2-sulfonate?
The canonical SMILES for [4-fluoro-3-(trifluoromethyl)phenyl] prop-1-ene-2-sulfonate is C=C(C)S(=O)(=O)Oc1ccc(F)c(C(F)(F)F)c1.
What is the InChIKey of [4-fluoro-3-(trifluoromethyl)phenyl] prop-1-ene-2-sulfonate?
The InChIKey is LEZYPTMIILFQDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F4O3S/c1-6(2)18(15,16)17-7-3-4-9(11)8(5-7)10(12,13)14/h3-5H,1H2,2H3.
What are the key properties of [4-fluoro-3-(trifluoromethyl)phenyl] prop-1-ene-2-sulfonate?
[4-fluoro-3-(trifluoromethyl)phenyl] prop-1-ene-2-sulfonate has a molecular weight of 284.23 g/mol, XLogP of 3.09, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-fluoro-3-(trifluoromethyl)phenyl] prop-1-ene-2-sulfonate is sourced from PubChem (CID 118593226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).