C24H15NaO7S — CID 102014859
sodium 6,7-dibenzoyloxynaphthalene-2-sulfonate (PubChem CID 102014859) has the molecular formula C24H15NaO7S and a molecular weight of 470.43 g/mol. Its IUPAC name is sodium 6,7-dibenzoyloxynaphthalene-2-sulfonate.
| Compound Name | sodium 6,7-dibenzoyloxynaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 102014859 |
| Molecular Formula | C24H15NaO7S |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | sodium 6,7-dibenzoyloxynaphthalene-2-sulfonate |
| SMILES | O=C(Oc1cc2ccc(S(=O)(=O)[O-])cc2cc1OC(=O)c1ccccc1)c1ccccc1.[Na+] |
| InChI | InChI=1S/C24H16O7S.Na/c25-23(16-7-3-1-4-8-16)30-21-14-18-11-12-20(32(27,28)29)13-19(18)15-22(21)31-24(26)17-9-5-2-6-10-17;/h1-15H,(H,27,28,29);/q;+1/p-1 |
| InChIKey | VJXJVXHCTROISL-UHFFFAOYSA-M |
| XLogP | 1.19 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|