C32H30N6O6S2 — CID 139120228
anthracene-2,6-disulfonate;bis(diaminomethylideneazanium);pyrene (PubChem CID 139120228) has the molecular formula C32H30N6O6S2 and a molecular weight of 658.76 g/mol. Its IUPAC name is anthracene-2,6-disulfonate;bis(diaminomethylideneazanium);pyrene.
| Compound Name | anthracene-2,6-disulfonate;bis(diaminomethylideneazanium);pyrene |
|---|---|
| PubChem CID | 139120228 |
| Molecular Formula | C32H30N6O6S2 |
| Molecular Weight | 658.76 g/mol |
| Exact Mass | 658.17 |
| IUPAC Name | anthracene-2,6-disulfonate;bis(diaminomethylideneazanium);pyrene |
| SMILES | NC(N)=[NH2+].NC(N)=[NH2+].O=S(=O)([O-])c1ccc2cc3cc(S(=O)(=O)[O-])ccc3cc2c1.c1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C16H10.C14H10O6S2.2CH5N3/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;15-21(16,17)13-3-1-9-5-12-8-14(22(18,19)20)4-2-10(12)6-11(9)7-13;2*2-1(3)4/h1-10H;1-8H,(H,15,16,17)(H,18,19,20);2*(H5,2,3,4) |
| InChIKey | DYFWCQUOOOAZEQ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 269.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.76 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|