C20H14F3N3O5S — CID 55792329
N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-3-fluoro-4-methyl-5-nitrobenzamide (PubChem CID 55792329) has the molecular formula C20H14F3N3O5S and a molecular weight of 465.41 g/mol. Its IUPAC name is N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-3-fluoro-4-methyl-5-nitrobenzamide.
| Compound Name | N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-3-fluoro-4-methyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 55792329 |
| Molecular Formula | C20H14F3N3O5S |
| Molecular Weight | 465.41 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-3-fluoro-4-methyl-5-nitrobenzamide |
| SMILES | Cc1c(F)cc(C(=O)Nc2ccc(NS(=O)(=O)c3ccc(F)c(F)c3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H14F3N3O5S/c1-11-17(22)8-12(9-19(11)26(28)29)20(27)24-13-2-4-14(5-3-13)25-32(30,31)15-6-7-16(21)18(23)10-15/h2-10,25H,1H3,(H,24,27) |
| InChIKey | AWXSDMDMGHZFOQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|