C19H14ClN5O7S — CID 3918311
N-(4-chlorophenyl)-3,5-dinitro-2-(4-sulfamoylanilino)benzamide (PubChem CID 3918311) has the molecular formula C19H14ClN5O7S and a molecular weight of 491.87 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3,5-dinitro-2-(4-sulfamoylanilino)benzamide.
| Compound Name | N-(4-chlorophenyl)-3,5-dinitro-2-(4-sulfamoylanilino)benzamide |
|---|---|
| PubChem CID | 3918311 |
| Molecular Formula | C19H14ClN5O7S |
| Molecular Weight | 491.87 g/mol |
| Exact Mass | 491.03 |
| IUPAC Name | N-(4-chlorophenyl)-3,5-dinitro-2-(4-sulfamoylanilino)benzamide |
| SMILES | NS(=O)(=O)c1ccc(Nc2c(C(=O)Nc3ccc(Cl)cc3)cc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H14ClN5O7S/c20-11-1-3-13(4-2-11)23-19(26)16-9-14(24(27)28)10-17(25(29)30)18(16)22-12-5-7-15(8-6-12)33(21,31)32/h1-10,22H,(H,23,26)(H2,21,31,32) |
| InChIKey | RWUBWYRSXXAWKI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 187.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.87 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|