C17H15ClN4O7 — CID 3718967
4-[2-[(4-chlorophenyl)carbamoyl]-4,6-dinitroanilino]butanoic acid (PubChem CID 3718967) has the molecular formula C17H15ClN4O7 and a molecular weight of 422.78 g/mol. Its IUPAC name is 4-[2-[(4-chlorophenyl)carbamoyl]-4,6-dinitroanilino]butanoic acid.
| Compound Name | 4-[2-[(4-chlorophenyl)carbamoyl]-4,6-dinitroanilino]butanoic acid |
|---|---|
| PubChem CID | 3718967 |
| Molecular Formula | C17H15ClN4O7 |
| Molecular Weight | 422.78 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 4-[2-[(4-chlorophenyl)carbamoyl]-4,6-dinitroanilino]butanoic acid |
| SMILES | O=C(O)CCCNc1c(C(=O)Nc2ccc(Cl)cc2)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15ClN4O7/c18-10-3-5-11(6-4-10)20-17(25)13-8-12(21(26)27)9-14(22(28)29)16(13)19-7-1-2-15(23)24/h3-6,8-9,19H,1-2,7H2,(H,20,25)(H,23,24) |
| InChIKey | GJRPJZVQDGIPDW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 164.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.78 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|