C15H11ClN4O8S — CID 4633767
N-[4-(acetylsulfamoyl)phenyl]-2-chloro-3,5-dinitrobenzamide (PubChem CID 4633767) has the molecular formula C15H11ClN4O8S and a molecular weight of 442.79 g/mol. Its IUPAC name is N-[4-(acetylsulfamoyl)phenyl]-2-chloro-3,5-dinitrobenzamide.
| Compound Name | N-[4-(acetylsulfamoyl)phenyl]-2-chloro-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4633767 |
| Molecular Formula | C15H11ClN4O8S |
| Molecular Weight | 442.79 g/mol |
| Exact Mass | 442.00 |
| IUPAC Name | N-[4-(acetylsulfamoyl)phenyl]-2-chloro-3,5-dinitrobenzamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2Cl)cc1 |
| InChI | InChI=1S/C15H11ClN4O8S/c1-8(21)18-29(27,28)11-4-2-9(3-5-11)17-15(22)12-6-10(19(23)24)7-13(14(12)16)20(25)26/h2-7H,1H3,(H,17,22)(H,18,21) |
| InChIKey | BORHZDQUIGYIOG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 178.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.79 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|