About 3-[(2,4,6-trichloroanilino)sulfamoyl]benzenesulfonamide
3-[(2,4,6-trichloroanilino)sulfamoyl]benzenesulfonamide (PubChem CID 31064906) has the molecular formula C12H10Cl3N3O4S2
and a molecular weight of 430.72 g/mol. Its IUPAC name is 3-[(2,4,6-trichloroanilino)sulfamoyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 3-[(2,4,6-trichloroanilino)sulfamoyl]benzenesulfonamide |
| PubChem CID | 31064906 |
| Molecular Formula | C12H10Cl3N3O4S2 |
| Molecular Weight | 430.72 g/mol |
| Exact Mass | 428.92 |
| IUPAC Name | 3-[(2,4,6-trichloroanilino)sulfamoyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(S(=O)(=O)NNc2c(Cl)cc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C12H10Cl3N3O4S2/c13-7-4-10(14)12(11(15)5-7)17-18-24(21,22)9-3-1-2-8(6-9)23(16,19)20/h1-6,17-18H,(H2,16,19,20) |
| InChIKey | HWTIPLKXQZZGNM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.72 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,4,6-trichloroanilino)sulfamoyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,4,6-trichloroanilino)sulfamoyl]benzenesulfonamide?
The IUPAC name of 3-[(2,4,6-trichloroanilino)sulfamoyl]benzenesulfonamide (CID 31064906) is 3-[(2,4,6-trichloroanilino)sulfamoyl]benzenesulfonamide.
What is the SMILES notation for 3-[(2,4,6-trichloroanilino)sulfamoyl]benzenesulfonamide?
The canonical SMILES for 3-[(2,4,6-trichloroanilino)sulfamoyl]benzenesulfonamide is NS(=O)(=O)c1cccc(S(=O)(=O)NNc2c(Cl)cc(Cl)cc2Cl)c1.
What is the InChIKey of 3-[(2,4,6-trichloroanilino)sulfamoyl]benzenesulfonamide?
The InChIKey is HWTIPLKXQZZGNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl3N3O4S2/c13-7-4-10(14)12(11(15)5-7)17-18-24(21,22)9-3-1-2-8(6-9)23(16,19)20/h1-6,17-18H,(H2,16,19,20).
What are the key properties of 3-[(2,4,6-trichloroanilino)sulfamoyl]benzenesulfonamide?
3-[(2,4,6-trichloroanilino)sulfamoyl]benzenesulfonamide has a molecular weight of 430.72 g/mol, XLogP of 2.60, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4,6-trichloroanilino)sulfamoyl]benzenesulfonamide is sourced from PubChem (CID 31064906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).