C15H14Cl3N3O3S — CID 26591384
N-ethyl-3-[(2,4,6-trichloroanilino)carbamoyl]benzenesulfonamide (PubChem CID 26591384) has the molecular formula C15H14Cl3N3O3S and a molecular weight of 422.72 g/mol. Its IUPAC name is N-ethyl-3-[(2,4,6-trichloroanilino)carbamoyl]benzenesulfonamide.
| Compound Name | N-ethyl-3-[(2,4,6-trichloroanilino)carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 26591384 |
| Molecular Formula | C15H14Cl3N3O3S |
| Molecular Weight | 422.72 g/mol |
| Exact Mass | 420.98 |
| IUPAC Name | N-ethyl-3-[(2,4,6-trichloroanilino)carbamoyl]benzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1cccc(C(=O)NNc2c(Cl)cc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C15H14Cl3N3O3S/c1-2-19-25(23,24)11-5-3-4-9(6-11)15(22)21-20-14-12(17)7-10(16)8-13(14)18/h3-8,19-20H,2H2,1H3,(H,21,22) |
| InChIKey | IURMPIKUSGADRO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.72 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|