C14H12Cl3N3O3S — CID 43033944
N-methyl-4-[(2,4,6-trichloroanilino)sulfamoyl]benzamide (PubChem CID 43033944) has the molecular formula C14H12Cl3N3O3S and a molecular weight of 408.69 g/mol. Its IUPAC name is N-methyl-4-[(2,4,6-trichloroanilino)sulfamoyl]benzamide.
| Compound Name | N-methyl-4-[(2,4,6-trichloroanilino)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 43033944 |
| Molecular Formula | C14H12Cl3N3O3S |
| Molecular Weight | 408.69 g/mol |
| Exact Mass | 406.97 |
| IUPAC Name | N-methyl-4-[(2,4,6-trichloroanilino)sulfamoyl]benzamide |
| SMILES | CNC(=O)c1ccc(S(=O)(=O)NNc2c(Cl)cc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C14H12Cl3N3O3S/c1-18-14(21)8-2-4-10(5-3-8)24(22,23)20-19-13-11(16)6-9(15)7-12(13)17/h2-7,19-20H,1H3,(H,18,21) |
| InChIKey | SLRDFPXFRBRNBO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.69 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|