C9H7FN4O4S2 — CID 115869758
3-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)-4-nitrobenzenesulfonamide (PubChem CID 115869758) has the molecular formula C9H7FN4O4S2 and a molecular weight of 318.31 g/mol. Its IUPAC name is 3-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)-4-nitrobenzenesulfonamide.
| Compound Name | 3-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 115869758 |
| Molecular Formula | C9H7FN4O4S2 |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 3-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)-4-nitrobenzenesulfonamide |
| SMILES | Cc1nnc(NS(=O)(=O)c2ccc([N+](=O)[O-])c(F)c2)s1 |
| InChI | InChI=1S/C9H7FN4O4S2/c1-5-11-12-9(19-5)13-20(17,18)6-2-3-8(14(15)16)7(10)4-6/h2-4H,1H3,(H,12,13) |
| InChIKey | GYCFBGWRUKLZEC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|