C10H11FN4O2S2 — CID 116792346
3-amino-5-fluoro-4-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide (PubChem CID 116792346) has the molecular formula C10H11FN4O2S2 and a molecular weight of 302.36 g/mol. Its IUPAC name is 3-amino-5-fluoro-4-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide.
| Compound Name | 3-amino-5-fluoro-4-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 116792346 |
| Molecular Formula | C10H11FN4O2S2 |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 3-amino-5-fluoro-4-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
| SMILES | Cc1nnc(NS(=O)(=O)c2cc(N)c(C)c(F)c2)s1 |
| InChI | InChI=1S/C10H11FN4O2S2/c1-5-8(11)3-7(4-9(5)12)19(16,17)15-10-14-13-6(2)18-10/h3-4H,12H2,1-2H3,(H,14,15) |
| InChIKey | IISSAMSXCAGMTP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|