C11H12FN3O3S — CID 116792354
3-amino-5-fluoro-4-methyl-N-(4-methyl-1,3-oxazol-2-yl)benzenesulfonamide (PubChem CID 116792354) has the molecular formula C11H12FN3O3S and a molecular weight of 285.30 g/mol. Its IUPAC name is 3-amino-5-fluoro-4-methyl-N-(4-methyl-1,3-oxazol-2-yl)benzenesulfonamide.
| Compound Name | 3-amino-5-fluoro-4-methyl-N-(4-methyl-1,3-oxazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 116792354 |
| Molecular Formula | C11H12FN3O3S |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 3-amino-5-fluoro-4-methyl-N-(4-methyl-1,3-oxazol-2-yl)benzenesulfonamide |
| SMILES | Cc1coc(NS(=O)(=O)c2cc(N)c(C)c(F)c2)n1 |
| InChI | InChI=1S/C11H12FN3O3S/c1-6-5-18-11(14-6)15-19(16,17)8-3-9(12)7(2)10(13)4-8/h3-5H,13H2,1-2H3,(H,14,15) |
| InChIKey | VSWJGKZGAOJDAV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|