C15H9Cl2N3O6S3 — CID 5157232
2,5-dichloro-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]benzenesulfonamide (PubChem CID 5157232) has the molecular formula C15H9Cl2N3O6S3 and a molecular weight of 494.36 g/mol. Its IUPAC name is 2,5-dichloro-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 5157232 |
| Molecular Formula | C15H9Cl2N3O6S3 |
| Molecular Weight | 494.36 g/mol |
| Exact Mass | 492.90 |
| IUPAC Name | 2,5-dichloro-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)c2cnc(NS(=O)(=O)c3cc(Cl)ccc3Cl)s2)cc1 |
| InChI | InChI=1S/C15H9Cl2N3O6S3/c16-9-1-6-12(17)13(7-9)29(25,26)19-15-18-8-14(27-15)28(23,24)11-4-2-10(3-5-11)20(21)22/h1-8H,(H,18,19) |
| InChIKey | JDWCVIKYJCNASO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 136.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|