C17H15N3O6S3 — CID 25331203
2,5-dimethyl-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]benzenesulfonamide (PubChem CID 25331203) has the molecular formula C17H15N3O6S3 and a molecular weight of 453.52 g/mol. Its IUPAC name is 2,5-dimethyl-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]benzenesulfonamide.
| Compound Name | 2,5-dimethyl-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 25331203 |
| Molecular Formula | C17H15N3O6S3 |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.01 |
| IUPAC Name | 2,5-dimethyl-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Nc2ncc(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)s2)c1 |
| InChI | InChI=1S/C17H15N3O6S3/c1-11-3-4-12(2)15(9-11)29(25,26)19-17-18-10-16(27-17)28(23,24)14-7-5-13(6-8-14)20(21)22/h3-10H,1-2H3,(H,18,19) |
| InChIKey | SHXRVFWVGZGTCM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 136.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|