C14H10F6N4O5S2 — CID 5070068
N-[1,1,1,3,3,3-hexafluoro-2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]propan-2-yl]acetamide (PubChem CID 5070068) has the molecular formula C14H10F6N4O5S2 and a molecular weight of 492.38 g/mol. Its IUPAC name is N-[1,1,1,3,3,3-hexafluoro-2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]propan-2-yl]acetamide.
| Compound Name | N-[1,1,1,3,3,3-hexafluoro-2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 5070068 |
| Molecular Formula | C14H10F6N4O5S2 |
| Molecular Weight | 492.38 g/mol |
| Exact Mass | 492.00 |
| IUPAC Name | N-[1,1,1,3,3,3-hexafluoro-2-[[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]amino]propan-2-yl]acetamide |
| SMILES | CC(=O)NC(Nc1ncc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)s1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H10F6N4O5S2/c1-7(25)22-12(13(15,16)17,14(18,19)20)23-11-21-6-10(30-11)31(28,29)9-4-2-8(3-5-9)24(26)27/h2-6H,1H3,(H,21,23)(H,22,25) |
| InChIKey | NSJHAOMYGBLJII-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 131.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|