C16H9ClN4O7S2 — CID 5167159
4-chloro-2-nitro-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]benzamide (PubChem CID 5167159) has the molecular formula C16H9ClN4O7S2 and a molecular weight of 468.86 g/mol. Its IUPAC name is 4-chloro-2-nitro-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-chloro-2-nitro-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 5167159 |
| Molecular Formula | C16H9ClN4O7S2 |
| Molecular Weight | 468.86 g/mol |
| Exact Mass | 467.96 |
| IUPAC Name | 4-chloro-2-nitro-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1ncc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)s1)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H9ClN4O7S2/c17-9-1-6-12(13(7-9)21(25)26)15(22)19-16-18-8-14(29-16)30(27,28)11-4-2-10(3-5-11)20(23)24/h1-8H,(H,18,19,22) |
| InChIKey | XJYRMYOMHOCNIW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 162.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.86 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|