C11H12N4O6S3 — CID 3288705
2-(dimethylsulfamoylamino)-5-(4-nitrophenyl)sulfonyl-1,3-thiazole (PubChem CID 3288705) has the molecular formula C11H12N4O6S3 and a molecular weight of 392.44 g/mol. Its IUPAC name is 2-(dimethylsulfamoylamino)-5-(4-nitrophenyl)sulfonyl-1,3-thiazole.
| Compound Name | 2-(dimethylsulfamoylamino)-5-(4-nitrophenyl)sulfonyl-1,3-thiazole |
|---|---|
| PubChem CID | 3288705 |
| Molecular Formula | C11H12N4O6S3 |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | 2-(dimethylsulfamoylamino)-5-(4-nitrophenyl)sulfonyl-1,3-thiazole |
| SMILES | CN(C)S(=O)(=O)Nc1ncc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C11H12N4O6S3/c1-14(2)24(20,21)13-11-12-7-10(22-11)23(18,19)9-5-3-8(4-6-9)15(16)17/h3-7H,1-2H3,(H,12,13) |
| InChIKey | RWSRVAWBUPXRAS-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 139.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|