C8H4Cl2N4O4S2 — CID 64607449
5,6-dichloro-N-(5-nitro-1,3-thiazol-2-yl)pyridine-3-sulfonamide (PubChem CID 64607449) has the molecular formula C8H4Cl2N4O4S2 and a molecular weight of 355.18 g/mol. Its IUPAC name is 5,6-dichloro-N-(5-nitro-1,3-thiazol-2-yl)pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-(5-nitro-1,3-thiazol-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64607449 |
| Molecular Formula | C8H4Cl2N4O4S2 |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 353.91 |
| IUPAC Name | 5,6-dichloro-N-(5-nitro-1,3-thiazol-2-yl)pyridine-3-sulfonamide |
| SMILES | O=[N+]([O-])c1cnc(NS(=O)(=O)c2cnc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C8H4Cl2N4O4S2/c9-5-1-4(2-11-7(5)10)20(17,18)13-8-12-3-6(19-8)14(15)16/h1-3H,(H,12,13) |
| InChIKey | CSTGPURCINNMJZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|