C21H23N5O3S — CID 52506063
N-[4-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 52506063) has the molecular formula C21H23N5O3S and a molecular weight of 425.51 g/mol. Its IUPAC name is N-[4-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-[4-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 52506063 |
| Molecular Formula | C21H23N5O3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | N-[4-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | CN1CCCCCC1=NS(=O)(=O)c1ccc(NC(=O)c2cn3ccccc3n2)cc1 |
| InChI | InChI=1S/C21H23N5O3S/c1-25-13-5-2-3-8-20(25)24-30(28,29)17-11-9-16(10-12-17)22-21(27)18-15-26-14-6-4-7-19(26)23-18/h4,6-7,9-12,14-15H,2-3,5,8,13H2,1H3,(H,22,27) |
| InChIKey | KZFXFURNRUVETQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 96.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|