C19H23N5O4S — CID 51956830
N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-6-oxo-1-propylpyridazine-3-carboxamide (PubChem CID 51956830) has the molecular formula C19H23N5O4S and a molecular weight of 417.49 g/mol. Its IUPAC name is N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-6-oxo-1-propylpyridazine-3-carboxamide.
| Compound Name | N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-6-oxo-1-propylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 51956830 |
| Molecular Formula | C19H23N5O4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-6-oxo-1-propylpyridazine-3-carboxamide |
| SMILES | CCCn1nc(C(=O)Nc2ccc(S(=O)(=O)N=C3CCCN3C)cc2)ccc1=O |
| InChI | InChI=1S/C19H23N5O4S/c1-3-12-24-18(25)11-10-16(21-24)19(26)20-14-6-8-15(9-7-14)29(27,28)22-17-5-4-13-23(17)2/h6-11H,3-5,12-13H2,1-2H3,(H,20,26) |
| InChIKey | VPMVENCHXGSJMS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|