C16H15N5O3S — CID 51255621
N-(4-methyl-3-sulfamoylphenyl)-2-phenyltriazole-4-carboxamide (PubChem CID 51255621) has the molecular formula C16H15N5O3S and a molecular weight of 357.40 g/mol. Its IUPAC name is N-(4-methyl-3-sulfamoylphenyl)-2-phenyltriazole-4-carboxamide.
| Compound Name | N-(4-methyl-3-sulfamoylphenyl)-2-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 51255621 |
| Molecular Formula | C16H15N5O3S |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N-(4-methyl-3-sulfamoylphenyl)-2-phenyltriazole-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cnn(-c3ccccc3)n2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C16H15N5O3S/c1-11-7-8-12(9-15(11)25(17,23)24)19-16(22)14-10-18-21(20-14)13-5-3-2-4-6-13/h2-10H,1H3,(H,19,22)(H2,17,23,24) |
| InChIKey | KIOZEMCAKZUMRP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |