C27H36N4O4S — CID 167273048
N-(3-cyclopentylsulfonylphenyl)-6-(2-hydroxyethylamino)-2-(4-propan-2-ylidenepiperidin-1-yl)pyridine-3-carboxamide (PubChem CID 167273048) has the molecular formula C27H36N4O4S and a molecular weight of 512.68 g/mol. Its IUPAC name is N-(3-cyclopentylsulfonylphenyl)-6-(2-hydroxyethylamino)-2-(4-propan-2-ylidenepiperidin-1-yl)pyridine-3-carboxamide.
| Compound Name | N-(3-cyclopentylsulfonylphenyl)-6-(2-hydroxyethylamino)-2-(4-propan-2-ylidenepiperidin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167273048 |
| Molecular Formula | C27H36N4O4S |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | N-(3-cyclopentylsulfonylphenyl)-6-(2-hydroxyethylamino)-2-(4-propan-2-ylidenepiperidin-1-yl)pyridine-3-carboxamide |
| SMILES | CC(C)=C1CCN(c2nc(NCCO)ccc2C(=O)Nc2cccc(S(=O)(=O)C3CCCC3)c2)CC1 |
| InChI | InChI=1S/C27H36N4O4S/c1-19(2)20-12-15-31(16-13-20)26-24(10-11-25(30-26)28-14-17-32)27(33)29-21-6-5-9-23(18-21)36(34,35)22-7-3-4-8-22/h5-6,9-11,18,22,32H,3-4,7-8,12-17H2,1-2H3,(H,28,30)(H,29,33) |
| InChIKey | WWAXHQFXTBFQAF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|