C14H13N3O6S — CID 23883710
[2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 4-ethoxybenzoate (PubChem CID 23883710) has the molecular formula C14H13N3O6S and a molecular weight of 351.34 g/mol. Its IUPAC name is [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 4-ethoxybenzoate.
| Compound Name | [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 23883710 |
| Molecular Formula | C14H13N3O6S |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)Nc2ncc([N+](=O)[O-])s2)cc1 |
| InChI | InChI=1S/C14H13N3O6S/c1-2-22-10-5-3-9(4-6-10)13(19)23-8-11(18)16-14-15-7-12(24-14)17(20)21/h3-7H,2,8H2,1H3,(H,15,16,18) |
| InChIKey | JAYPOROOBCSFBA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|