C14H11N3O7S — CID 23738805
[2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 2,3-dihydro-1,4-benzodioxine-6-carboxylate (PubChem CID 23738805) has the molecular formula C14H11N3O7S and a molecular weight of 365.32 g/mol. Its IUPAC name is [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 2,3-dihydro-1,4-benzodioxine-6-carboxylate.
| Compound Name | [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 2,3-dihydro-1,4-benzodioxine-6-carboxylate |
|---|---|
| PubChem CID | 23738805 |
| Molecular Formula | C14H11N3O7S |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 2,3-dihydro-1,4-benzodioxine-6-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)OCCO2)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C14H11N3O7S/c18-11(16-14-15-6-12(25-14)17(20)21)7-24-13(19)8-1-2-9-10(5-8)23-4-3-22-9/h1-2,5-6H,3-4,7H2,(H,15,16,18) |
| InChIKey | YYQIRXJTNMLDEX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|